C13H18I3NO2 — CID 115475970
1-(tert-butylamino)-3-(2,4,6-triiodophenoxy)propan-2-ol (PubChem CID 115475970) has the molecular formula C13H18I3NO2 and a molecular weight of 601.00 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(2,4,6-triiodophenoxy)propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-(2,4,6-triiodophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 115475970 |
| Molecular Formula | C13H18I3NO2 |
| Molecular Weight | 601.00 g/mol |
| Exact Mass | 600.85 |
| IUPAC Name | 1-(tert-butylamino)-3-(2,4,6-triiodophenoxy)propan-2-ol |
| SMILES | CC(C)(C)NCC(O)COc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C13H18I3NO2/c1-13(2,3)17-6-9(18)7-19-12-10(15)4-8(14)5-11(12)16/h4-5,9,17-18H,6-7H2,1-3H3 |
| InChIKey | BXKVUKQGHQAYBE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.00 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|