C13H20INO2 — CID 101075385
(2S)-1-(tert-butylamino)-3-(4-iodophenoxy)propan-2-ol (PubChem CID 101075385) has the molecular formula C13H20INO2 and a molecular weight of 349.21 g/mol. Its IUPAC name is (2S)-1-(tert-butylamino)-3-(4-iodophenoxy)propan-2-ol.
| Compound Name | (2S)-1-(tert-butylamino)-3-(4-iodophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 101075385 |
| Molecular Formula | C13H20INO2 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | (2S)-1-(tert-butylamino)-3-(4-iodophenoxy)propan-2-ol |
| SMILES | CC(C)(C)NC[C@H](O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C13H20INO2/c1-13(2,3)15-8-11(16)9-17-12-6-4-10(14)5-7-12/h4-7,11,15-16H,8-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | OZDKZFSTJCGNHH-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|