C15H27N3O2 — CID 20513342
1-(tert-butylamino)-3-(2,3-diamino-4,5-dimethylphenoxy)propan-2-ol (PubChem CID 20513342) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(2,3-diamino-4,5-dimethylphenoxy)propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-(2,3-diamino-4,5-dimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 20513342 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-(tert-butylamino)-3-(2,3-diamino-4,5-dimethylphenoxy)propan-2-ol |
| SMILES | Cc1cc(OCC(O)CNC(C)(C)C)c(N)c(N)c1C |
| InChI | InChI=1S/C15H27N3O2/c1-9-6-12(14(17)13(16)10(9)2)20-8-11(19)7-18-15(3,4)5/h6,11,18-19H,7-8,16-17H2,1-5H3 |
| InChIKey | PSOUMYHXOBPLDF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|