C13H23BrCl2N2O2 — CID 21421211
1-(2-amino-5-bromophenoxy)-3-(tert-butylamino)propan-2-ol;dihydrochloride (PubChem CID 21421211) has the molecular formula C13H23BrCl2N2O2 and a molecular weight of 390.15 g/mol. Its IUPAC name is 1-(2-amino-5-bromophenoxy)-3-(tert-butylamino)propan-2-ol;dihydrochloride.
| Compound Name | 1-(2-amino-5-bromophenoxy)-3-(tert-butylamino)propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 21421211 |
| Molecular Formula | C13H23BrCl2N2O2 |
| Molecular Weight | 390.15 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 1-(2-amino-5-bromophenoxy)-3-(tert-butylamino)propan-2-ol;dihydrochloride |
| SMILES | CC(C)(C)NCC(O)COc1cc(Br)ccc1N.Cl.Cl |
| InChI | InChI=1S/C13H21BrN2O2.2ClH/c1-13(2,3)16-7-10(17)8-18-12-6-9(14)4-5-11(12)15;;/h4-6,10,16-17H,7-8,15H2,1-3H3;2*1H |
| InChIKey | VRRPMZOPOIZCEN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|