C14H21Cl2NO4 — CID 139024800
3-[3-(tert-butylamino)-2-hydroxypropoxy]-4-chlorobenzoic acid;hydrochloride (PubChem CID 139024800) has the molecular formula C14H21Cl2NO4 and a molecular weight of 338.23 g/mol. Its IUPAC name is 3-[3-(tert-butylamino)-2-hydroxypropoxy]-4-chlorobenzoic acid;hydrochloride.
| Compound Name | 3-[3-(tert-butylamino)-2-hydroxypropoxy]-4-chlorobenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 139024800 |
| Molecular Formula | C14H21Cl2NO4 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-[3-(tert-butylamino)-2-hydroxypropoxy]-4-chlorobenzoic acid;hydrochloride |
| SMILES | CC(C)(C)NCC(O)COc1cc(C(=O)O)ccc1Cl.Cl |
| InChI | InChI=1S/C14H20ClNO4.ClH/c1-14(2,3)16-7-10(17)8-20-12-6-9(13(18)19)4-5-11(12)15;/h4-6,10,16-17H,7-8H2,1-3H3,(H,18,19);1H |
| InChIKey | MLRXLRNVTNCZEL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |