C21H27ClN2O3 — CID 14853073
N-benzyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-chlorobenzamide (PubChem CID 14853073) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is N-benzyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-chlorobenzamide.
| Compound Name | N-benzyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-chlorobenzamide |
|---|---|
| PubChem CID | 14853073 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-benzyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-chlorobenzamide |
| SMILES | CC(C)(C)NCC(O)COc1ccc(C(=O)NCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H27ClN2O3/c1-21(2,3)24-13-17(25)14-27-19-10-9-16(11-18(19)22)20(26)23-12-15-7-5-4-6-8-15/h4-11,17,24-25H,12-14H2,1-3H3,(H,23,26) |
| InChIKey | PMAHLWUJEAXPFC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |