C21H36N2O7 — CID 24905848
1-(tert-butylamino)-3-[4-[(tert-butylamino)methyl]-2-methoxyphenoxy]propan-2-ol;oxalic acid (PubChem CID 24905848) has the molecular formula C21H36N2O7 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[4-[(tert-butylamino)methyl]-2-methoxyphenoxy]propan-2-ol;oxalic acid.
| Compound Name | 1-(tert-butylamino)-3-[4-[(tert-butylamino)methyl]-2-methoxyphenoxy]propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 24905848 |
| Molecular Formula | C21H36N2O7 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-(tert-butylamino)-3-[4-[(tert-butylamino)methyl]-2-methoxyphenoxy]propan-2-ol;oxalic acid |
| SMILES | COc1cc(CNC(C)(C)C)ccc1OCC(O)CNC(C)(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H34N2O3.C2H2O4/c1-18(2,3)20-11-14-8-9-16(17(10-14)23-7)24-13-15(22)12-21-19(4,5)6;3-1(4)2(5)6/h8-10,15,20-22H,11-13H2,1-7H3;(H,3,4)(H,5,6) |
| InChIKey | BCUHXTZMDGJKNM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|