C14H21NO7 — CID 45074838
1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid (PubChem CID 45074838) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 45074838 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid |
| SMILES | COc1ccc(CNCC(C)O)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H19NO3.C2H2O4/c1-9(14)7-13-8-10-4-5-11(15-2)12(6-10)16-3;3-1(4)2(5)6/h4-6,9,13-14H,7-8H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | VWQOGUGTNDFHPG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|