1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid

C14H21NO7 — CID 45074838

IUPAC1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid
SMILESCOc1ccc(CNCC(C)O)cc1OC.O=C(O)C(=O)O
InChIInChI=1S/C12H19NO3.C2H2O4/c1-9(14)7-13-8-10-4-5-11(15-2)12(6-10)16-3;3-1(4)2(5)6/h4-6,9,13-14H,7-8H2,1-3H3;(H,3,4)(H,5,6)
InChIKeyVWQOGUGTNDFHPG-UHFFFAOYSA-N
MW315.32 g/mol
LogP0.33
Rot. Bonds6

About 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid

1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid (PubChem CID 45074838) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid.

Molecular Properties

Compound Name1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid
PubChem CID45074838
Molecular FormulaC14H21NO7
Molecular Weight315.32 g/mol
Exact Mass315.13
IUPAC Name1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid
SMILESCOc1ccc(CNCC(C)O)cc1OC.O=C(O)C(=O)O
InChIInChI=1S/C12H19NO3.C2H2O4/c1-9(14)7-13-8-10-4-5-11(15-2)12(6-10)16-3;3-1(4)2(5)6/h4-6,9,13-14H,7-8H2,1-3H3;(H,3,4)(H,5,6)
InChIKeyVWQOGUGTNDFHPG-UHFFFAOYSA-N
XLogP0.33
TPSA125.32 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.32
LogP ≤ 50.33
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid?
The IUPAC name of 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid (CID 45074838) is 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid.
What is the SMILES notation for 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid?
The canonical SMILES for 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid is COc1ccc(CNCC(C)O)cc1OC.O=C(O)C(=O)O.
What is the InChIKey of 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid?
The InChIKey is VWQOGUGTNDFHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3.C2H2O4/c1-9(14)7-13-8-10-4-5-11(15-2)12(6-10)16-3;3-1(4)2(5)6/h4-6,9,13-14H,7-8H2,1-3H3;(H,3,4)(H,5,6).
What are the key properties of 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid?
1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid has a molecular weight of 315.32 g/mol, XLogP of 0.33, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dimethoxyphenyl)methylamino]propan-2-ol;oxalic acid is sourced from PubChem (CID 45074838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).