2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid

C12H18N2O4 — CID 64583436

IUPAC2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid
SMILESCOc1ccc(CNCC(N)C(=O)O)cc1OC
InChIInChI=1S/C12H18N2O4/c1-17-10-4-3-8(5-11(10)18-2)6-14-7-9(13)12(15)16/h3-5,9,14H,6-7,13H2,1-2H3,(H,15,16)
InChIKeyYLBWCCRBNJJNNQ-UHFFFAOYSA-N
MW254.29 g/mol
LogP0.21
Rot. Bonds7

About 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid

2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid (PubChem CID 64583436) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid.

Molecular Properties

Compound Name2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid
PubChem CID64583436
Molecular FormulaC12H18N2O4
Molecular Weight254.29 g/mol
Exact Mass254.13
IUPAC Name2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid
SMILESCOc1ccc(CNCC(N)C(=O)O)cc1OC
InChIInChI=1S/C12H18N2O4/c1-17-10-4-3-8(5-11(10)18-2)6-14-7-9(13)12(15)16/h3-5,9,14H,6-7,13H2,1-2H3,(H,15,16)
InChIKeyYLBWCCRBNJJNNQ-UHFFFAOYSA-N
XLogP0.21
TPSA93.81 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 50.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid?
The IUPAC name of 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid (CID 64583436) is 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid.
What is the SMILES notation for 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid?
The canonical SMILES for 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid is COc1ccc(CNCC(N)C(=O)O)cc1OC.
What is the InChIKey of 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid?
The InChIKey is YLBWCCRBNJJNNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-17-10-4-3-8(5-11(10)18-2)6-14-7-9(13)12(15)16/h3-5,9,14H,6-7,13H2,1-2H3,(H,15,16).
What are the key properties of 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid?
2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid has a molecular weight of 254.29 g/mol, XLogP of 0.21, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(3,4-dimethoxyphenyl)methylamino]propanoic acid is sourced from PubChem (CID 64583436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).