C22H29ClNO3- — CID 53346768
1-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one chloride (PubChem CID 53346768) has the molecular formula C22H29ClNO3- and a molecular weight of 390.93 g/mol. Its IUPAC name is 1-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one chloride.
| Compound Name | 1-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one chloride |
|---|---|
| PubChem CID | 53346768 |
| Molecular Formula | C22H29ClNO3- |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one chloride |
| SMILES | CC(C)(C)NCC(O)COc1ccccc1C(=O)CCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H29NO3.ClH/c1-22(2,3)23-15-18(24)16-26-21-12-8-7-11-19(21)20(25)14-13-17-9-5-4-6-10-17;/h4-12,18,23-24H,13-16H2,1-3H3;1H/p-1 |
| InChIKey | PXBGAENZBXUROI-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |