C24H30N2O3 — CID 3066297
1-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-(1H-indol-4-yl)propan-1-one (PubChem CID 3066297) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is 1-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-(1H-indol-4-yl)propan-1-one.
| Compound Name | 1-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-(1H-indol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 3066297 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-(1H-indol-4-yl)propan-1-one |
| SMILES | CC(C)(C)NCC(O)COc1ccccc1C(=O)CCc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C24H30N2O3/c1-24(2,3)26-15-18(27)16-29-23-10-5-4-8-20(23)22(28)12-11-17-7-6-9-21-19(17)13-14-25-21/h4-10,13-14,18,25-27H,11-12,15-16H2,1-3H3 |
| InChIKey | UWPLIZCLRBHFQA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |