C21H26N2O5 — CID 67681123
2-hydroxybenzoic acid;1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 67681123) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 2-hydroxybenzoic acid;1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 67681123 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-hydroxybenzoic acid;1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1cccc2[nH]ccc12.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C14H20N2O2.C7H6O3/c1-10(2)16-8-11(17)9-18-14-5-3-4-13-12(14)6-7-15-13;8-6-4-2-1-3-5(6)7(9)10/h3-7,10-11,15-17H,8-9H2,1-2H3;1-4,8H,(H,9,10) |
| InChIKey | MQIOHXZGDJCAMA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |