C21H30N2O3 — CID 154158543
[1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)propan-2-yl] cyclohexanecarboxylate (PubChem CID 154158543) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is [1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)propan-2-yl] cyclohexanecarboxylate.
| Compound Name | [1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)propan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 154158543 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | [1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)propan-2-yl] cyclohexanecarboxylate |
| SMILES | CC(C)NCC(COc1cccc2[nH]ccc12)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H30N2O3/c1-15(2)23-13-17(26-21(24)16-7-4-3-5-8-16)14-25-20-10-6-9-19-18(20)11-12-22-19/h6,9-12,15-17,22-23H,3-5,7-8,13-14H2,1-2H3 |
| InChIKey | SGWQXISZWUQRLK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |