C48H54N4O6 — CID 57287339
bis[1-(4-benzylpiperidin-1-yl)-3-(1H-indol-4-yloxy)propan-2-yl] oxalate (PubChem CID 57287339) has the molecular formula C48H54N4O6 and a molecular weight of 782.98 g/mol. Its IUPAC name is bis[1-(4-benzylpiperidin-1-yl)-3-(1H-indol-4-yloxy)propan-2-yl] oxalate.
| Compound Name | bis[1-(4-benzylpiperidin-1-yl)-3-(1H-indol-4-yloxy)propan-2-yl] oxalate |
|---|---|
| PubChem CID | 57287339 |
| Molecular Formula | C48H54N4O6 |
| Molecular Weight | 782.98 g/mol |
| Exact Mass | 782.40 |
| IUPAC Name | bis[1-(4-benzylpiperidin-1-yl)-3-(1H-indol-4-yloxy)propan-2-yl] oxalate |
| SMILES | O=C(OC(COc1cccc2[nH]ccc12)CN1CCC(Cc2ccccc2)CC1)C(=O)OC(COc1cccc2[nH]ccc12)CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C48H54N4O6/c53-47(57-39(33-55-45-15-7-13-43-41(45)17-23-49-43)31-51-25-19-37(20-26-51)29-35-9-3-1-4-10-35)48(54)58-40(34-56-46-16-8-14-44-42(46)18-24-50-44)32-52-27-21-38(22-28-52)30-36-11-5-2-6-12-36/h1-18,23-24,37-40,49-50H,19-22,25-34H2 |
| InChIKey | WTCAGOSOVXPVMC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.98 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|