C52H62N4O8 — CID 57310468
bis[1-(4-benzylpiperidin-1-yl)-3-[(1-methyl-2-oxo-3,4-dihydroquinolin-5-yl)oxy]propan-2-yl] oxalate (PubChem CID 57310468) has the molecular formula C52H62N4O8 and a molecular weight of 871.09 g/mol. Its IUPAC name is bis[1-(4-benzylpiperidin-1-yl)-3-[(1-methyl-2-oxo-3,4-dihydroquinolin-5-yl)oxy]propan-2-yl] oxalate.
| Compound Name | bis[1-(4-benzylpiperidin-1-yl)-3-[(1-methyl-2-oxo-3,4-dihydroquinolin-5-yl)oxy]propan-2-yl] oxalate |
|---|---|
| PubChem CID | 57310468 |
| Molecular Formula | C52H62N4O8 |
| Molecular Weight | 871.09 g/mol |
| Exact Mass | 870.46 |
| IUPAC Name | bis[1-(4-benzylpiperidin-1-yl)-3-[(1-methyl-2-oxo-3,4-dihydroquinolin-5-yl)oxy]propan-2-yl] oxalate |
| SMILES | CN1C(=O)CCc2c(OCC(CN3CCC(Cc4ccccc4)CC3)OC(=O)C(=O)OC(COc3cccc4c3CCC(=O)N4C)CN3CCC(Cc4ccccc4)CC3)cccc21 |
| InChI | InChI=1S/C52H62N4O8/c1-53-45-15-9-17-47(43(45)19-21-49(53)57)61-35-41(33-55-27-23-39(24-28-55)31-37-11-5-3-6-12-37)63-51(59)52(60)64-42(34-56-29-25-40(26-30-56)32-38-13-7-4-8-14-38)36-62-48-18-10-16-46-44(48)20-22-50(58)54(46)2/h3-18,39-42H,19-36H2,1-2H3 |
| InChIKey | SDWCVYFWHBSTMA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.09 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|