C25H31N3O7 — CID 12899470
5-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-1-methyl-3,4-dihydroquinolin-2-one;oxalic acid (PubChem CID 12899470) has the molecular formula C25H31N3O7 and a molecular weight of 485.54 g/mol. Its IUPAC name is 5-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-1-methyl-3,4-dihydroquinolin-2-one;oxalic acid.
| Compound Name | 5-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-1-methyl-3,4-dihydroquinolin-2-one;oxalic acid |
|---|---|
| PubChem CID | 12899470 |
| Molecular Formula | C25H31N3O7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 5-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-1-methyl-3,4-dihydroquinolin-2-one;oxalic acid |
| SMILES | CN1C(=O)CCc2c(OCC(O)CN3CCN(c4ccccc4)CC3)cccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H29N3O3.C2H2O4/c1-24-21-8-5-9-22(20(21)10-11-23(24)28)29-17-19(27)16-25-12-14-26(15-13-25)18-6-3-2-4-7-18;3-1(4)2(5)6/h2-9,19,27H,10-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PEGKQHZFDQQHLL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|