C21H28N2O2 — CID 2882652
1-(2,6-dimethylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol (PubChem CID 2882652) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-(2,6-dimethylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 2882652 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol |
| SMILES | Cc1cccc(C)c1OCC(O)CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N2O2/c1-17-7-6-8-18(2)21(17)25-16-20(24)15-22-11-13-23(14-12-22)19-9-4-3-5-10-19/h3-10,20,24H,11-16H2,1-2H3 |
| InChIKey | CSOMHMHYUVRRBR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |