C21H28Cl2N2O2-2 — CID 21237602
1-(2,4-dimethylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol dichloride (PubChem CID 21237602) has the molecular formula C21H28Cl2N2O2-2 and a molecular weight of 411.37 g/mol. Its IUPAC name is 1-(2,4-dimethylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol dichloride.
| Compound Name | 1-(2,4-dimethylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol dichloride |
|---|---|
| PubChem CID | 21237602 |
| Molecular Formula | C21H28Cl2N2O2-2 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-(2,4-dimethylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol dichloride |
| SMILES | Cc1ccc(OCC(O)CN2CCN(c3ccccc3)CC2)c(C)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C21H28N2O2.2ClH/c1-17-8-9-21(18(2)14-17)25-16-20(24)15-22-10-12-23(13-11-22)19-6-4-3-5-7-19;;/h3-9,14,20,24H,10-13,15-16H2,1-2H3;2*1H/p-2 |
| InChIKey | MXNFXUFQKOQLHQ-UHFFFAOYSA-L |
| XLogP | -3.13 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |