C38H48N4O6 — CID 67742525
bis[1-(cyclohexylamino)-3-(1H-indol-4-yloxy)propan-2-yl] (Z)-but-2-enedioate (PubChem CID 67742525) has the molecular formula C38H48N4O6 and a molecular weight of 656.82 g/mol. Its IUPAC name is bis[1-(cyclohexylamino)-3-(1H-indol-4-yloxy)propan-2-yl] (Z)-but-2-enedioate.
| Compound Name | bis[1-(cyclohexylamino)-3-(1H-indol-4-yloxy)propan-2-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67742525 |
| Molecular Formula | C38H48N4O6 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.36 |
| IUPAC Name | bis[1-(cyclohexylamino)-3-(1H-indol-4-yloxy)propan-2-yl] (Z)-but-2-enedioate |
| SMILES | O=C(/C=C\C(=O)OC(CNC1CCCCC1)COc1cccc2[nH]ccc12)OC(CNC1CCCCC1)COc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C38H48N4O6/c43-37(47-29(23-41-27-9-3-1-4-10-27)25-45-35-15-7-13-33-31(35)19-21-39-33)17-18-38(44)48-30(24-42-28-11-5-2-6-12-28)26-46-36-16-8-14-34-32(36)20-22-40-34/h7-8,13-22,27-30,39-42H,1-6,9-12,23-26H2/b18-17- |
| InChIKey | BMAKEDRMFOZOMD-ZCXUNETKSA-N |
| XLogP | 6.33 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|