C40H56N2O6 — CID 57135087
bis[1-(cyclopentylamino)-3-(2-cyclopentylphenoxy)propan-2-yl] oxalate (PubChem CID 57135087) has the molecular formula C40H56N2O6 and a molecular weight of 660.90 g/mol. Its IUPAC name is bis[1-(cyclopentylamino)-3-(2-cyclopentylphenoxy)propan-2-yl] oxalate.
| Compound Name | bis[1-(cyclopentylamino)-3-(2-cyclopentylphenoxy)propan-2-yl] oxalate |
|---|---|
| PubChem CID | 57135087 |
| Molecular Formula | C40H56N2O6 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | bis[1-(cyclopentylamino)-3-(2-cyclopentylphenoxy)propan-2-yl] oxalate |
| SMILES | O=C(OC(CNC1CCCC1)COc1ccccc1C1CCCC1)C(=O)OC(CNC1CCCC1)COc1ccccc1C1CCCC1 |
| InChI | InChI=1S/C40H56N2O6/c43-39(47-33(25-41-31-17-5-6-18-31)27-45-37-23-11-9-21-35(37)29-13-1-2-14-29)40(44)48-34(26-42-32-19-7-8-20-32)28-46-38-24-12-10-22-36(38)30-15-3-4-16-30/h9-12,21-24,29-34,41-42H,1-8,13-20,25-28H2 |
| InChIKey | NFXZWMLSCZQASI-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|