C22H37NO2 — CID 70048759
1-(2-cycloheptylphenoxy)-3-(3-methylpentan-2-ylamino)propan-2-ol (PubChem CID 70048759) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is 1-(2-cycloheptylphenoxy)-3-(3-methylpentan-2-ylamino)propan-2-ol.
| Compound Name | 1-(2-cycloheptylphenoxy)-3-(3-methylpentan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 70048759 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 1-(2-cycloheptylphenoxy)-3-(3-methylpentan-2-ylamino)propan-2-ol |
| SMILES | CCC(C)C(C)NCC(O)COc1ccccc1C1CCCCCC1 |
| InChI | InChI=1S/C22H37NO2/c1-4-17(2)18(3)23-15-20(24)16-25-22-14-10-9-13-21(22)19-11-7-5-6-8-12-19/h9-10,13-14,17-20,23-24H,4-8,11-12,15-16H2,1-3H3 |
| InChIKey | UHJNVFVQMFHTLB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |