C22H34N2O7 — CID 11282059
[(2S)-1-(tert-butylamino)-3-(2-cyclopentylphenoxy)propan-2-yl] 2-(2-nitrooxyethoxy)acetate (PubChem CID 11282059) has the molecular formula C22H34N2O7 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(2S)-1-(tert-butylamino)-3-(2-cyclopentylphenoxy)propan-2-yl] 2-(2-nitrooxyethoxy)acetate.
| Compound Name | [(2S)-1-(tert-butylamino)-3-(2-cyclopentylphenoxy)propan-2-yl] 2-(2-nitrooxyethoxy)acetate |
|---|---|
| PubChem CID | 11282059 |
| Molecular Formula | C22H34N2O7 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | [(2S)-1-(tert-butylamino)-3-(2-cyclopentylphenoxy)propan-2-yl] 2-(2-nitrooxyethoxy)acetate |
| SMILES | CC(C)(C)NC[C@@H](COc1ccccc1C1CCCC1)OC(=O)COCCO[N+](=O)[O-] |
| InChI | InChI=1S/C22H34N2O7/c1-22(2,3)23-14-18(31-21(25)16-28-12-13-30-24(26)27)15-29-20-11-7-6-10-19(20)17-8-4-5-9-17/h6-7,10-11,17-18,23H,4-5,8-9,12-16H2,1-3H3/t18-/m0/s1 |
| InChIKey | AYEATHMGLCBQDJ-SFHVURJKSA-N |
| XLogP | 3.25 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|