C19H29NO6 — CID 70620124
[1-(tert-butylamino)-3-[[(6R,7R)-4,6,7-trihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]propan-2-yl] acetate (PubChem CID 70620124) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is [1-(tert-butylamino)-3-[[(6R,7R)-4,6,7-trihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]propan-2-yl] acetate.
| Compound Name | [1-(tert-butylamino)-3-[[(6R,7R)-4,6,7-trihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]propan-2-yl] acetate |
|---|---|
| PubChem CID | 70620124 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | [1-(tert-butylamino)-3-[[(6R,7R)-4,6,7-trihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]propan-2-yl] acetate |
| SMILES | CC(=O)OC(CNC(C)(C)C)COc1ccc(O)c2c1C[C@@H](O)[C@H](O)C2 |
| InChI | InChI=1S/C19H29NO6/c1-11(21)26-12(9-20-19(2,3)4)10-25-18-6-5-15(22)13-7-16(23)17(24)8-14(13)18/h5-6,12,16-17,20,22-24H,7-10H2,1-4H3/t12?,16-,17-/m1/s1 |
| InChIKey | DSUBWXKRKQCCBL-RIJFORKLSA-N |
| XLogP | 0.91 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |