C17H25NO4 — CID 10425337
[1-(propan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-yl] acetate (PubChem CID 10425337) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is [1-(propan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-yl] acetate.
| Compound Name | [1-(propan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-yl] acetate |
|---|---|
| PubChem CID | 10425337 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [1-(propan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-yl] acetate |
| SMILES | C=CCOc1ccccc1OCC(CNC(C)C)OC(C)=O |
| InChI | InChI=1S/C17H25NO4/c1-5-10-20-16-8-6-7-9-17(16)21-12-15(22-14(4)19)11-18-13(2)3/h5-9,13,15,18H,1,10-12H2,2-4H3 |
| InChIKey | RVJSWQVJXPCRCT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|