C20H29NO5 — CID 15615402
5-oxo-5-[1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-yl]oxypentanoic acid (PubChem CID 15615402) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 5-oxo-5-[1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-yl]oxypentanoic acid.
| Compound Name | 5-oxo-5-[1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 15615402 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 5-oxo-5-[1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-yl]oxypentanoic acid |
| SMILES | C=CCc1ccccc1OCC(CNC(C)C)OC(=O)CCCC(=O)O |
| InChI | InChI=1S/C20H29NO5/c1-4-8-16-9-5-6-10-18(16)25-14-17(13-21-15(2)3)26-20(24)12-7-11-19(22)23/h4-6,9-10,15,17,21H,1,7-8,11-14H2,2-3H3,(H,22,23) |
| InChIKey | KNEJJHKHIRRGIJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|