C19H28NO3+ — CID 5124164
[1-piperidin-1-ium-1-yl-3-(2-prop-2-enylphenoxy)propan-2-yl] acetate (PubChem CID 5124164) has the molecular formula C19H28NO3+ and a molecular weight of 318.44 g/mol. Its IUPAC name is [1-piperidin-1-ium-1-yl-3-(2-prop-2-enylphenoxy)propan-2-yl] acetate.
| Compound Name | [1-piperidin-1-ium-1-yl-3-(2-prop-2-enylphenoxy)propan-2-yl] acetate |
|---|---|
| PubChem CID | 5124164 |
| Molecular Formula | C19H28NO3+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | [1-piperidin-1-ium-1-yl-3-(2-prop-2-enylphenoxy)propan-2-yl] acetate |
| SMILES | C=CCc1ccccc1OCC(C[NH+]1CCCCC1)OC(C)=O |
| InChI | InChI=1S/C19H27NO3/c1-3-9-17-10-5-6-11-19(17)22-15-18(23-16(2)21)14-20-12-7-4-8-13-20/h3,5-6,10-11,18H,1,4,7-9,12-15H2,2H3/p+1 |
| InChIKey | HNMXRGSFHXPKGG-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|