C17H27NO4 — CID 76973216
5-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol (PubChem CID 76973216) has the molecular formula C17H27NO4 and a molecular weight of 318.46 g/mol. Its IUPAC name is 5-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol.
| Compound Name | 5-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 76973216 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 5-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| SMILES | [2H]C([2H])([2H])C(NCC(O)COc1cccc2c1CC(O)C(O)C2)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3/i1D3,2D3,3D3 |
| InChIKey | VWPOSFSPZNDTMJ-GQALSZNTSA-N |
| XLogP | 0.63 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |