C16H24N2O6 — CID 14839763
[8-[3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-chromen-3-yl] nitrate (PubChem CID 14839763) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is [8-[3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-chromen-3-yl] nitrate.
| Compound Name | [8-[3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-chromen-3-yl] nitrate |
|---|---|
| PubChem CID | 14839763 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [8-[3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-chromen-3-yl] nitrate |
| SMILES | CC(C)(C)NCC(O)COc1cccc2c1OCC(O[N+](=O)[O-])C2 |
| InChI | InChI=1S/C16H24N2O6/c1-16(2,3)17-8-12(19)9-22-14-6-4-5-11-7-13(24-18(20)21)10-23-15(11)14/h4-6,12-13,17,19H,7-10H2,1-3H3 |
| InChIKey | GOPCFCXTHDGOIW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|