C19H20N2O8S — CID 70380330
[(3R)-3-nitrooxy-3,4-dihydro-2H-chromen-8-yl] 2-(methanesulfonamido)-3-phenylpropanoate (PubChem CID 70380330) has the molecular formula C19H20N2O8S and a molecular weight of 436.44 g/mol. Its IUPAC name is [(3R)-3-nitrooxy-3,4-dihydro-2H-chromen-8-yl] 2-(methanesulfonamido)-3-phenylpropanoate.
| Compound Name | [(3R)-3-nitrooxy-3,4-dihydro-2H-chromen-8-yl] 2-(methanesulfonamido)-3-phenylpropanoate |
|---|---|
| PubChem CID | 70380330 |
| Molecular Formula | C19H20N2O8S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [(3R)-3-nitrooxy-3,4-dihydro-2H-chromen-8-yl] 2-(methanesulfonamido)-3-phenylpropanoate |
| SMILES | CS(=O)(=O)NC(Cc1ccccc1)C(=O)Oc1cccc2c1OC[C@H](O[N+](=O)[O-])C2 |
| InChI | InChI=1S/C19H20N2O8S/c1-30(25,26)20-16(10-13-6-3-2-4-7-13)19(22)28-17-9-5-8-14-11-15(29-21(23)24)12-27-18(14)17/h2-9,15-16,20H,10-12H2,1H3/t15-,16?/m1/s1 |
| InChIKey | DCRRTQYSPYNPEN-AAFJCEBUSA-N |
| XLogP | 1.26 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|