C18H19NO4S — CID 167838567
2-(2,3-dihydro-1H-inden-2-ylsulfonylamino)-3-phenylpropanoic acid (PubChem CID 167838567) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-ylsulfonylamino)-3-phenylpropanoic acid.
| Compound Name | 2-(2,3-dihydro-1H-inden-2-ylsulfonylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 167838567 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-ylsulfonylamino)-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)NS(=O)(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H19NO4S/c20-18(21)17(10-13-6-2-1-3-7-13)19-24(22,23)16-11-14-8-4-5-9-15(14)12-16/h1-9,16-17,19H,10-12H2,(H,20,21) |
| InChIKey | BLMLNXQTPWLGAI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |