C14H21N3O4S — CID 70057612
2-[(4-methylpiperazin-1-yl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 70057612) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(4-methylpiperazin-1-yl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70057612 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | CN1CCN(S(=O)(=O)NC(Cc2ccccc2)C(=O)O)CC1 |
| InChI | InChI=1S/C14H21N3O4S/c1-16-7-9-17(10-8-16)22(20,21)15-13(14(18)19)11-12-5-3-2-4-6-12/h2-6,13,15H,7-11H2,1H3,(H,18,19) |
| InChIKey | FVNISLPEDHUYBH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |