C22H32N2O7 — CID 18710690
2-[[3-[(6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2-hydroxypropyl]amino]-2,4-dimethyl-4-nitrosoheptane-3,5-dione (PubChem CID 18710690) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[[3-[(6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2-hydroxypropyl]amino]-2,4-dimethyl-4-nitrosoheptane-3,5-dione.
| Compound Name | 2-[[3-[(6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2-hydroxypropyl]amino]-2,4-dimethyl-4-nitrosoheptane-3,5-dione |
|---|---|
| PubChem CID | 18710690 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-[[3-[(6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2-hydroxypropyl]amino]-2,4-dimethyl-4-nitrosoheptane-3,5-dione |
| SMILES | CCC(=O)C(C)(N=O)C(=O)C(C)(C)NCC(O)COc1cccc2c1CC(O)C(O)C2 |
| InChI | InChI=1S/C22H32N2O7/c1-5-19(28)22(4,24-30)20(29)21(2,3)23-11-14(25)12-31-18-8-6-7-13-9-16(26)17(27)10-15(13)18/h6-8,14,16-17,23,25-27H,5,9-12H2,1-4H3 |
| InChIKey | KOJOCYDMOMRPKY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 145.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|