C21H30N2O5 — CID 18710661
1-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2,3-dihydro-1H-inden-1-yl]-4-methyl-4-nitrosopentane-2,3-dione (PubChem CID 18710661) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2,3-dihydro-1H-inden-1-yl]-4-methyl-4-nitrosopentane-2,3-dione.
| Compound Name | 1-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2,3-dihydro-1H-inden-1-yl]-4-methyl-4-nitrosopentane-2,3-dione |
|---|---|
| PubChem CID | 18710661 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2,3-dihydro-1H-inden-1-yl]-4-methyl-4-nitrosopentane-2,3-dione |
| SMILES | CC(C)NCC(O)COc1cccc2c1CCC2CC(=O)C(=O)C(C)(C)N=O |
| InChI | InChI=1S/C21H30N2O5/c1-13(2)22-11-15(24)12-28-19-7-5-6-16-14(8-9-17(16)19)10-18(25)20(26)21(3,4)23-27/h5-7,13-15,22,24H,8-12H2,1-4H3 |
| InChIKey | YRFSOTHHTLPZQH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|