C12H17Cl2NO2 — CID 13055703
1-(2,3-dichlorophenoxy)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 13055703) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 1-(2,3-dichlorophenoxy)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-(2,3-dichlorophenoxy)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 13055703 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1-(2,3-dichlorophenoxy)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H17Cl2NO2/c1-8(2)15-6-9(16)7-17-11-5-3-4-10(13)12(11)14/h3-5,8-9,15-16H,6-7H2,1-2H3 |
| InChIKey | XDUKLDUEBNKUKP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |