C14H20Cl2N2O3 — CID 119305104
2-amino-N-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]pentanamide (PubChem CID 119305104) has the molecular formula C14H20Cl2N2O3 and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-amino-N-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]pentanamide.
| Compound Name | 2-amino-N-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]pentanamide |
|---|---|
| PubChem CID | 119305104 |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-amino-N-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]pentanamide |
| SMILES | CCCC(N)C(=O)NCC(O)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl2N2O3/c1-2-4-11(17)14(20)18-7-9(19)8-21-12-6-3-5-10(15)13(12)16/h3,5-6,9,11,19H,2,4,7-8,17H2,1H3,(H,18,20) |
| InChIKey | SVESHVAJCXCUQR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |