C18H28Cl2N4O3 — CID 111385492
N-tert-butyl-2-[[[[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]amino]-(ethylamino)methylidene]amino]acetamide (PubChem CID 111385492) has the molecular formula C18H28Cl2N4O3 and a molecular weight of 419.35 g/mol. Its IUPAC name is N-tert-butyl-2-[[[[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]amino]-(ethylamino)methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[[[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]amino]-(ethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111385492 |
| Molecular Formula | C18H28Cl2N4O3 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-tert-butyl-2-[[[[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]amino]-(ethylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(O)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H28Cl2N4O3/c1-5-21-17(23-10-15(26)24-18(2,3)4)22-9-12(25)11-27-14-8-6-7-13(19)16(14)20/h6-8,12,25H,5,9-11H2,1-4H3,(H,24,26)(H2,21,22,23) |
| InChIKey | UOQCCFCRPWOJSD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|