C21H34ClN5O — CID 111383632
N-tert-butyl-2-[[[[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-(ethylamino)methylidene]amino]acetamide (PubChem CID 111383632) has the molecular formula C21H34ClN5O and a molecular weight of 407.99 g/mol. Its IUPAC name is N-tert-butyl-2-[[[[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-(ethylamino)methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[[[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-(ethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111383632 |
| Molecular Formula | C21H34ClN5O |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-tert-butyl-2-[[[[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-(ethylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(c1cccc(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C21H34ClN5O/c1-5-23-20(25-15-19(28)26-21(2,3)4)24-14-18(27-11-6-7-12-27)16-9-8-10-17(22)13-16/h8-10,13,18H,5-7,11-12,14-15H2,1-4H3,(H,26,28)(H2,23,24,25) |
| InChIKey | UWHHWPFDZHHBQA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|