C18H25ClN4 — CID 111848869
2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-1-ethyl-3-prop-2-ynylguanidine (PubChem CID 111848869) has the molecular formula C18H25ClN4 and a molecular weight of 332.88 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-1-ethyl-3-prop-2-ynylguanidine.
| Compound Name | 2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-1-ethyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111848869 |
| Molecular Formula | C18H25ClN4 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-1-ethyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CC(c1cccc(Cl)c1)N1CCCC1)NCC |
| InChI | InChI=1S/C18H25ClN4/c1-3-10-21-18(20-4-2)22-14-17(23-11-5-6-12-23)15-8-7-9-16(19)13-15/h1,7-9,13,17H,4-6,10-12,14H2,2H3,(H2,20,21,22) |
| InChIKey | ZFJUEQIBWCUPRN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|