C22H36ClIN4O — CID 111960788
N'-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111960788) has the molecular formula C22H36ClIN4O and a molecular weight of 534.91 g/mol. Its IUPAC name is N'-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111960788 |
| Molecular Formula | C22H36ClIN4O |
| Molecular Weight | 534.91 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | N'-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccc(Cl)c1)N1CCCC1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C22H35ClN4O.HI/c1-3-24-22(27-14-10-20(11-15-27)28-4-2)25-17-21(26-12-5-6-13-26)18-8-7-9-19(23)16-18;/h7-9,16,20-21H,3-6,10-15,17H2,1-2H3,(H,24,25);1H |
| InChIKey | PPTNDMABKBZAFR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.91 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|