C24H41IN4O2 — CID 111959170
4-ethoxy-N-ethyl-N'-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111959170) has the molecular formula C24H41IN4O2 and a molecular weight of 544.52 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959170 |
| Molecular Formula | C24H41IN4O2 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1OC)N1CCCCC1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C24H40N4O2.HI/c1-4-25-24(28-17-13-20(14-18-28)30-5-2)26-19-22(27-15-9-6-10-16-27)21-11-7-8-12-23(21)29-3;/h7-8,11-12,20,22H,4-6,9-10,13-19H2,1-3H3,(H,25,26);1H |
| InChIKey | LPWHCHGLVCTWCB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|