C17H26ClN3O — CID 111960053
N-[2-(3-chlorophenyl)ethyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide (PubChem CID 111960053) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111960053 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N/C)NCCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H26ClN3O/c1-3-22-16-8-11-21(12-9-16)17(19-2)20-10-7-14-5-4-6-15(18)13-14/h4-6,13,16H,3,7-12H2,1-2H3,(H,19,20) |
| InChIKey | VGTHXXLBXVRNJJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|