C15H25I2N3OS — CID 111959310
4-ethoxy-N-[2-(5-iodothiophen-2-yl)ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111959310) has the molecular formula C15H25I2N3OS and a molecular weight of 549.26 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(5-iodothiophen-2-yl)ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-[2-(5-iodothiophen-2-yl)ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959310 |
| Molecular Formula | C15H25I2N3OS |
| Molecular Weight | 549.26 g/mol |
| Exact Mass | 548.98 |
| IUPAC Name | 4-ethoxy-N-[2-(5-iodothiophen-2-yl)ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N/C)NCCc2ccc(I)s2)CC1.I |
| InChI | InChI=1S/C15H24IN3OS.HI/c1-3-20-12-7-10-19(11-8-12)15(17-2)18-9-6-13-4-5-14(16)21-13;/h4-5,12H,3,6-11H2,1-2H3,(H,17,18);1H |
| InChIKey | DXSWKQZPCLIXEL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|