C16H24IN3O2S — CID 111157975
ethyl 1-[N-[2-(5-iodothiophen-2-yl)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111157975) has the molecular formula C16H24IN3O2S and a molecular weight of 449.36 g/mol. Its IUPAC name is ethyl 1-[N-[2-(5-iodothiophen-2-yl)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-[2-(5-iodothiophen-2-yl)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111157975 |
| Molecular Formula | C16H24IN3O2S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | ethyl 1-[N-[2-(5-iodothiophen-2-yl)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCc2ccc(I)s2)CC1 |
| InChI | InChI=1S/C16H24IN3O2S/c1-3-22-15(21)12-7-10-20(11-8-12)16(18-2)19-9-6-13-4-5-14(17)23-13/h4-5,12H,3,6-11H2,1-2H3,(H,18,19) |
| InChIKey | SMEZXKXWLXZNMP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|