C13H22F3N3O2 — CID 111983779
ethyl 1-[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111983779) has the molecular formula C13H22F3N3O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111983779 |
| Molecular Formula | C13H22F3N3O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl 1-[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3N3O2/c1-3-21-11(20)10-4-8-19(9-5-10)12(17-2)18-7-6-13(14,15)16/h10H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | SFVWDPDXXAUVIF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|