C17H32N4O3 — CID 111156289
ethyl 1-[N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111156289) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is ethyl 1-[N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111156289 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | ethyl 1-[N-[3-(butan-2-ylamino)-3-oxopropyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCC(=O)NC(C)CC)CC1 |
| InChI | InChI=1S/C17H32N4O3/c1-5-13(3)20-15(22)7-10-19-17(18-4)21-11-8-14(9-12-21)16(23)24-6-2/h13-14H,5-12H2,1-4H3,(H,18,19)(H,20,22) |
| InChIKey | HRTSJKZFSUOZPA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|