C19H27F3IN3O3 — CID 111157136
ethyl 1-[N'-methyl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111157136) has the molecular formula C19H27F3IN3O3 and a molecular weight of 529.34 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111157136 |
| Molecular Formula | C19H27F3IN3O3 |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCc2ccc(OC(F)(F)F)cc2)CC1.I |
| InChI | InChI=1S/C19H26F3N3O3.HI/c1-3-27-17(26)15-9-12-25(13-10-15)18(23-2)24-11-8-14-4-6-16(7-5-14)28-19(20,21)22;/h4-7,15H,3,8-13H2,1-2H3,(H,23,24);1H |
| InChIKey | WOFXSCQSLYWZSD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|