C14H26IN5O2 — CID 111960298
4-ethoxy-N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111960298) has the molecular formula C14H26IN5O2 and a molecular weight of 423.30 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111960298 |
| Molecular Formula | C14H26IN5O2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N/C)NCCc2nc(C)no2)CC1.I |
| InChI | InChI=1S/C14H25N5O2.HI/c1-4-20-12-6-9-19(10-7-12)14(15-3)16-8-5-13-17-11(2)18-21-13;/h12H,4-10H2,1-3H3,(H,15,16);1H |
| InChIKey | OBFXIOPZBJWQPU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|