C16H28N6O3 — CID 111730893
tert-butyl N-[1-[N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730893) has the molecular formula C16H28N6O3 and a molecular weight of 352.44 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730893 |
| Molecular Formula | C16H28N6O3 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl N-[1-[N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(\NCCc1nc(C)no1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H28N6O3/c1-11-19-13(25-21-11)6-8-18-14(17-5)22-9-7-12(10-22)20-15(23)24-16(2,3)4/h12H,6-10H2,1-5H3,(H,17,18)(H,20,23) |
| InChIKey | QEFRBQPWLKUDLZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|