C16H28N4OS — CID 111960671
4-ethoxy-N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1-carboximidamide (PubChem CID 111960671) has the molecular formula C16H28N4OS and a molecular weight of 324.49 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111960671 |
| Molecular Formula | C16H28N4OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N/C)NCCCc2nc(C)cs2)CC1 |
| InChI | InChI=1S/C16H28N4OS/c1-4-21-14-7-10-20(11-8-14)16(17-3)18-9-5-6-15-19-13(2)12-22-15/h12,14H,4-11H2,1-3H3,(H,17,18) |
| InChIKey | NUZRNBHFQIUKER-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|