C19H26F2IN5S — CID 109450642
4-(2,5-difluorophenyl)-N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109450642) has the molecular formula C19H26F2IN5S and a molecular weight of 521.42 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450642 |
| Molecular Formula | C19H26F2IN5S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C)cs1)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C19H25F2N5S.HI/c1-14-13-27-18(24-14)4-3-7-23-19(22-2)26-10-8-25(9-11-26)17-12-15(20)5-6-16(17)21;/h5-6,12-13H,3-4,7-11H2,1-2H3,(H,22,23);1H |
| InChIKey | GYRVBTFSRNNYRM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|